About 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol
1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol (PubChem CID 46943586) has the molecular formula C21H16FNOS
and a molecular weight of 349.43 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol.
Molecular Properties
| Compound Name | 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol |
| PubChem CID | 46943586 |
| Molecular Formula | C21H16FNOS |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.09 |
| IUPAC Name | 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol |
| SMILES | CC(O)(c1cccc(F)c1)c1nc(-c2ccc3ccccc3c2)cs1 |
| InChI | InChI=1S/C21H16FNOS/c1-21(24,17-7-4-8-18(22)12-17)20-23-19(13-25-20)16-10-9-14-5-2-3-6-15(14)11-16/h2-13,24H,1H3 |
| InChIKey | UIBVJRJHLOGFJD-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol?
The IUPAC name of 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol (CID 46943586) is 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol.
What is the SMILES notation for 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol?
The canonical SMILES for 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol is CC(O)(c1cccc(F)c1)c1nc(-c2ccc3ccccc3c2)cs1.
What is the InChIKey of 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol?
The InChIKey is UIBVJRJHLOGFJD-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H16FNOS/c1-21(24,17-7-4-8-18(22)12-17)20-23-19(13-25-20)16-10-9-14-5-2-3-6-15(14)11-16/h2-13,24H,1H3.
What are the key properties of 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol?
1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol has a molecular weight of 349.43 g/mol, XLogP of 5.36, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-fluorophenyl)-1-(4-naphthalen-2-yl-1,3-thiazol-2-yl)ethanol is sourced from PubChem (CID 46943586), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).