C25H25N3O6 — CID 46943780
N-[6-(2,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide (PubChem CID 46943780) has the molecular formula C25H25N3O6 and a molecular weight of 463.49 g/mol. Its IUPAC name is N-[6-(2,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide.
| Compound Name | N-[6-(2,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide |
|---|---|
| PubChem CID | 46943780 |
| Molecular Formula | C25H25N3O6 |
| Molecular Weight | 463.49 g/mol |
| Exact Mass | 463.17 |
| IUPAC Name | N-[6-(2,4-dimethoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide |
| SMILES | COc1ccc(-c2cc(NC=O)c3ncc(-c4cc(OC)c(OC)c(OC)c4)n3c2)c(OC)c1 |
| InChI | InChI=1S/C25H25N3O6/c1-30-17-6-7-18(21(11-17)31-2)16-8-19(27-14-29)25-26-12-20(28(25)13-16)15-9-22(32-3)24(34-5)23(10-15)33-4/h6-14H,1-5H3,(H,27,29) |
| InChIKey | VQVKFQXMYFTUOW-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 92.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.49 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|