C23H15F4N5O — CID 46943822
3-quinolin-8-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine (PubChem CID 46943822) has the molecular formula C23H15F4N5O and a molecular weight of 453.40 g/mol. Its IUPAC name is 3-quinolin-8-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine.
| Compound Name | 3-quinolin-8-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine |
|---|---|
| PubChem CID | 46943822 |
| Molecular Formula | C23H15F4N5O |
| Molecular Weight | 453.40 g/mol |
| Exact Mass | 453.12 |
| IUPAC Name | 3-quinolin-8-yl-N-[3-(1,1,2,2-tetrafluoroethoxy)phenyl]imidazo[1,2-a]pyrazin-8-amine |
| SMILES | FC(F)C(F)(F)Oc1cccc(Nc2nccn3c(-c4cccc5cccnc45)cnc23)c1 |
| InChI | InChI=1S/C23H15F4N5O/c24-22(25)23(26,27)33-16-7-2-6-15(12-16)31-20-21-30-13-18(32(21)11-10-29-20)17-8-1-4-14-5-3-9-28-19(14)17/h1-13,22H,(H,29,31) |
| InChIKey | GYGKEMOOKJTBJH-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 64.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.40 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|