About (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol
(4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol (PubChem CID 46943951) has the molecular formula C20H16F3NO2S
and a molecular weight of 391.41 g/mol. Its IUPAC name is (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol |
| PubChem CID | 46943951 |
| Molecular Formula | C20H16F3NO2S |
| Molecular Weight | 391.41 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol |
| SMILES | COc1ccc(C(O)c2nc(/C=C/c3ccc(C(F)(F)F)cc3)cs2)cc1 |
| InChI | InChI=1S/C20H16F3NO2S/c1-26-17-10-5-14(6-11-17)18(25)19-24-16(12-27-19)9-4-13-2-7-15(8-3-13)20(21,22)23/h2-12,18,25H,1H3/b9-4+ |
| InChIKey | BZUSZRCLBUEUOJ-RUDMXATFSA-N |
| XLogP | 5.42 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 391.41 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol?
The IUPAC name of (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol (CID 46943951) is (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol.
What is the SMILES notation for (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol?
The canonical SMILES for (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol is COc1ccc(C(O)c2nc(/C=C/c3ccc(C(F)(F)F)cc3)cs2)cc1.
What is the InChIKey of (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol?
The InChIKey is BZUSZRCLBUEUOJ-RUDMXATFSA-N. The full InChI is InChI=1S/C20H16F3NO2S/c1-26-17-10-5-14(6-11-17)18(25)19-24-16(12-27-19)9-4-13-2-7-15(8-3-13)20(21,22)23/h2-12,18,25H,1H3/b9-4+.
What are the key properties of (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol?
(4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol has a molecular weight of 391.41 g/mol, XLogP of 5.42, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-[4-[(E)-2-[4-(trifluoromethyl)phenyl]ethenyl]-1,3-thiazol-2-yl]methanol is sourced from PubChem (CID 46943951), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).