C24H22FN3O5 — CID 46943953
N-[6-(5-fluoro-2-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide (PubChem CID 46943953) has the molecular formula C24H22FN3O5 and a molecular weight of 451.45 g/mol. Its IUPAC name is N-[6-(5-fluoro-2-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide.
| Compound Name | N-[6-(5-fluoro-2-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide |
|---|---|
| PubChem CID | 46943953 |
| Molecular Formula | C24H22FN3O5 |
| Molecular Weight | 451.45 g/mol |
| Exact Mass | 451.15 |
| IUPAC Name | N-[6-(5-fluoro-2-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide |
| SMILES | COc1ccc(F)cc1-c1cc(NC=O)c2ncc(-c3cc(OC)c(OC)c(OC)c3)n2c1 |
| InChI | InChI=1S/C24H22FN3O5/c1-30-20-6-5-16(25)10-17(20)15-7-18(27-13-29)24-26-11-19(28(24)12-15)14-8-21(31-2)23(33-4)22(9-14)32-3/h5-13H,1-4H3,(H,27,29) |
| InChIKey | KEJUWAZNDNMWJN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.45 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|