C15H18N6OS — CID 46944015
2-N-(2-methoxyethyl)-4-N-[(5-methylpyrazin-2-yl)methyl]thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 46944015) has the molecular formula C15H18N6OS and a molecular weight of 330.42 g/mol. Its IUPAC name is 2-N-(2-methoxyethyl)-4-N-[(5-methylpyrazin-2-yl)methyl]thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 2-N-(2-methoxyethyl)-4-N-[(5-methylpyrazin-2-yl)methyl]thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46944015 |
| Molecular Formula | C15H18N6OS |
| Molecular Weight | 330.42 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 2-N-(2-methoxyethyl)-4-N-[(5-methylpyrazin-2-yl)methyl]thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(NCc2cnc(C)cn2)c2sccc2n1 |
| InChI | InChI=1S/C15H18N6OS/c1-10-7-18-11(8-17-10)9-19-14-13-12(3-6-23-13)20-15(21-14)16-4-5-22-2/h3,6-8H,4-5,9H2,1-2H3,(H2,16,19,20,21) |
| InChIKey | SRLVFZVOJORASU-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 84.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.42 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|