About N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide
N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide (PubChem CID 46944152) has the molecular formula C11H18N2O3S
and a molecular weight of 258.34 g/mol. Its IUPAC name is N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide |
| PubChem CID | 46944152 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide |
| SMILES | CCN(CC)C(=O)c1csc(COCCO)n1 |
| InChI | InChI=1S/C11H18N2O3S/c1-3-13(4-2)11(15)9-8-17-10(12-9)7-16-6-5-14/h8,14H,3-7H2,1-2H3 |
| InChIKey | SDXWWBLZXGUJHP-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 62.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide?
The IUPAC name of N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide (CID 46944152) is N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide.
What is the SMILES notation for N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide?
The canonical SMILES for N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide is CCN(CC)C(=O)c1csc(COCCO)n1.
What is the InChIKey of N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide?
The InChIKey is SDXWWBLZXGUJHP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2O3S/c1-3-13(4-2)11(15)9-8-17-10(12-9)7-16-6-5-14/h8,14H,3-7H2,1-2H3.
What are the key properties of N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide?
N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide has a molecular weight of 258.34 g/mol, XLogP of 1.13, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-2-(2-hydroxyethoxymethyl)-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 46944152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).