methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate

C15H30O3Si — CID 46944390

IUPACmethyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate
SMILESCCC[C@@H](C/C=C\C(=O)OC)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C15H30O3Si/c1-8-10-13(11-9-12-14(16)17-5)18-19(6,7)15(2,3)4/h9,12-13H,8,10-11H2,1-7H3/b12-9-/t13-/m0/s1
InChIKeyYHLCVSXYLDZXDP-SUIFULHWSA-N
MW286.49 g/mol
LogP4.30
Rot. Bonds7

About methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate

methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate (PubChem CID 46944390) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate.

Molecular Properties

Compound Namemethyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate
PubChem CID46944390
Molecular FormulaC15H30O3Si
Molecular Weight286.49 g/mol
Exact Mass286.20
IUPAC Namemethyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate
SMILESCCC[C@@H](C/C=C\C(=O)OC)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C15H30O3Si/c1-8-10-13(11-9-12-14(16)17-5)18-19(6,7)15(2,3)4/h9,12-13H,8,10-11H2,1-7H3/b12-9-/t13-/m0/s1
InChIKeyYHLCVSXYLDZXDP-SUIFULHWSA-N
XLogP4.30
TPSA35.53 Ų
H-Bond Donors
H-Bond Acceptors3
Rotatable Bonds7
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500286.49
LogP ≤ 54.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate?
The IUPAC name of methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate (CID 46944390) is methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate.
What is the SMILES notation for methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate?
The canonical SMILES for methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate is CCC[C@@H](C/C=C\C(=O)OC)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate?
The InChIKey is YHLCVSXYLDZXDP-SUIFULHWSA-N. The full InChI is InChI=1S/C15H30O3Si/c1-8-10-13(11-9-12-14(16)17-5)18-19(6,7)15(2,3)4/h9,12-13H,8,10-11H2,1-7H3/b12-9-/t13-/m0/s1.
What are the key properties of methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate?
methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate has a molecular weight of 286.49 g/mol, XLogP of 4.30, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (Z,5S)-5-[tert-butyl(dimethyl)silyl]oxyoct-2-enoate is sourced from PubChem (CID 46944390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).