C15H32OS3Si — CID 46944471
(Z,3R)-1,1,1-tris(ethylsulfanyl)-6-trimethylsilylhex-5-en-3-ol (PubChem CID 46944471) has the molecular formula C15H32OS3Si and a molecular weight of 352.71 g/mol. Its IUPAC name is (Z,3R)-1,1,1-tris(ethylsulfanyl)-6-trimethylsilylhex-5-en-3-ol.
| Compound Name | (Z,3R)-1,1,1-tris(ethylsulfanyl)-6-trimethylsilylhex-5-en-3-ol |
|---|---|
| PubChem CID | 46944471 |
| Molecular Formula | C15H32OS3Si |
| Molecular Weight | 352.71 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | (Z,3R)-1,1,1-tris(ethylsulfanyl)-6-trimethylsilylhex-5-en-3-ol |
| SMILES | CCSC(C[C@H](O)C/C=C\[Si](C)(C)C)(SCC)SCC |
| InChI | InChI=1S/C15H32OS3Si/c1-7-17-15(18-8-2,19-9-3)13-14(16)11-10-12-20(4,5)6/h10,12,14,16H,7-9,11,13H2,1-6H3/b12-10-/t14-/m1/s1 |
| InChIKey | GETWSTOHDGENNV-GAJOTYCWSA-N |
| XLogP | 5.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.71 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|