2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid

C10H16O2 — CID 46944497

IUPAC2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid
SMILESCC1(C)CC=CC1(C)CC(=O)O
InChIInChI=1S/C10H16O2/c1-9(2)5-4-6-10(9,3)7-8(11)12/h4,6H,5,7H2,1-3H3,(H,11,12)
InChIKeyLXOMVDVBQFDFRS-UHFFFAOYSA-N
MW168.24 g/mol
LogP2.45
Rot. Bonds2

About 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid

2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid (PubChem CID 46944497) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid.

Molecular Properties

Compound Name2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid
PubChem CID46944497
Molecular FormulaC10H16O2
Molecular Weight168.24 g/mol
Exact Mass168.12
IUPAC Name2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid
SMILESCC1(C)CC=CC1(C)CC(=O)O
InChIInChI=1S/C10H16O2/c1-9(2)5-4-6-10(9,3)7-8(11)12/h4,6H,5,7H2,1-3H3,(H,11,12)
InChIKeyLXOMVDVBQFDFRS-UHFFFAOYSA-N
XLogP2.45
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds2
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500168.24
LogP ≤ 52.45
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid?
The IUPAC name of 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid (CID 46944497) is 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid.
What is the SMILES notation for 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid?
The canonical SMILES for 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid is CC1(C)CC=CC1(C)CC(=O)O.
What is the InChIKey of 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid?
The InChIKey is LXOMVDVBQFDFRS-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-9(2)5-4-6-10(9,3)7-8(11)12/h4,6H,5,7H2,1-3H3,(H,11,12).
What are the key properties of 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid?
2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid has a molecular weight of 168.24 g/mol, XLogP of 2.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,5,5-trimethylcyclopent-2-en-1-yl)acetic acid is sourced from PubChem (CID 46944497), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).