About CID 46944507
CID 46944507 (PubChem CID 46944507) has the molecular formula C23H24BrFeN3+2
and a molecular weight of 478.22 g/mol.
Molecular Properties
| Compound Name | CID 46944507 |
| PubChem CID | 46944507 |
| Molecular Formula | C23H24BrFeN3+2 |
| Molecular Weight | 478.22 g/mol |
| Exact Mass | 477.05 |
| IUPAC Name | — |
| SMILES | Brc1ccc2nc([C]3[CH][CH][CH][CH]3)c(NC3CCCCC3)n2c1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C18H19BrN3.C5H5.Fe/c19-14-10-11-16-21-17(13-6-4-5-7-13)18(22(16)12-14)20-15-8-2-1-3-9-15;1-2-4-5-3-1;/h4-7,10-12,15,20H,1-3,8-9H2;1-5H;/q;;+2 |
| InChIKey | BKMJXIQYKKPWLB-UHFFFAOYSA-N |
| XLogP | 5.61 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 478.22 |
| LogP ≤ 5 | 5.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 46944507 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 46944507?
The IUPAC name of CID 46944507 (CID 46944507) is not available.
What is the SMILES notation for CID 46944507?
The canonical SMILES for CID 46944507 is Brc1ccc2nc([C]3[CH][CH][CH][CH]3)c(NC3CCCCC3)n2c1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 46944507?
The InChIKey is BKMJXIQYKKPWLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H19BrN3.C5H5.Fe/c19-14-10-11-16-21-17(13-6-4-5-7-13)18(22(16)12-14)20-15-8-2-1-3-9-15;1-2-4-5-3-1;/h4-7,10-12,15,20H,1-3,8-9H2;1-5H;/q;;+2.
What are the key properties of CID 46944507?
CID 46944507 has a molecular weight of 478.22 g/mol, XLogP of 5.61, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for CID 46944507 is sourced from PubChem (CID 46944507), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).