C12H25O8S+ — CID 46945259
(2S,3R,4S,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-methoxyhexane-1,2,3,5-tetrol (PubChem CID 46945259) has the molecular formula C12H25O8S+ and a molecular weight of 329.39 g/mol. Its IUPAC name is (2S,3R,4S,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-methoxyhexane-1,2,3,5-tetrol.
| Compound Name | (2S,3R,4S,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-methoxyhexane-1,2,3,5-tetrol |
|---|---|
| PubChem CID | 46945259 |
| Molecular Formula | C12H25O8S+ |
| Molecular Weight | 329.39 g/mol |
| Exact Mass | 329.13 |
| IUPAC Name | (2S,3R,4S,5S)-6-[(2R,3S,4S)-3,4-dihydroxy-2-(hydroxymethyl)thiolan-1-ium-1-yl]-4-methoxyhexane-1,2,3,5-tetrol |
| SMILES | CO[C@@H]([C@H](O)[C@@H](O)CO)[C@H](O)C[S+]1C[C@@H](O)[C@H](O)[C@H]1CO |
| InChI | InChI=1S/C12H25O8S/c1-20-12(11(19)6(15)2-13)8(17)5-21-4-7(16)10(18)9(21)3-14/h6-19H,2-5H2,1H3/q+1/t6-,7+,8+,9+,10-,11+,12+,21?/m0/s1 |
| InChIKey | ZFLJGAPPQIUCTG-HPDDBWTRSA-N |
| XLogP | -4.21 |
| TPSA | 150.84 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.39 |
| LogP ≤ 5 | -4.21 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|