C36H28O8 — CID 46945296
[(1R,2R,9R,10R)-13,19,25-triacetyloxy-5-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3(8),4,6,11(16),12,14,17(22),18,20,23(28),24,26-dodecaenyl] acetate (PubChem CID 46945296) has the molecular formula C36H28O8 and a molecular weight of 588.61 g/mol. Its IUPAC name is [(1R,2R,9R,10R)-13,19,25-triacetyloxy-5-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3(8),4,6,11(16),12,14,17(22),18,20,23(28),24,26-dodecaenyl] acetate.
| Compound Name | [(1R,2R,9R,10R)-13,19,25-triacetyloxy-5-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3(8),4,6,11(16),12,14,17(22),18,20,23(28),24,26-dodecaenyl] acetate |
|---|---|
| PubChem CID | 46945296 |
| Molecular Formula | C36H28O8 |
| Molecular Weight | 588.61 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | [(1R,2R,9R,10R)-13,19,25-triacetyloxy-5-heptacyclo[8.6.6.62,9.03,8.011,16.017,22.023,28]octacosa-3(8),4,6,11(16),12,14,17(22),18,20,23(28),24,26-dodecaenyl] acetate |
| SMILES | CC(=O)Oc1ccc2c(c1)[C@H]1c3ccc(OC(C)=O)cc3[C@@H]2[C@@H]2c3ccc(OC(C)=O)cc3[C@H]1c1ccc(OC(C)=O)cc12 |
| InChI | InChI=1S/C36H28O8/c1-17(37)41-21-5-9-25-29(13-21)33-26-10-6-22(42-18(2)38)14-30(26)34(25)36-28-12-8-23(43-19(3)39)15-31(28)35(33)27-11-7-24(16-32(27)36)44-20(4)40/h5-16,33-36H,1-4H3/t33-,34-,35-,36-/m1/s1 |
| InChIKey | GFOJUFCEDBVKKN-MGXDLYCJSA-N |
| XLogP | 6.26 |
| TPSA | 105.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.61 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|