About trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine
trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine (PubChem CID 46945518) has the molecular formula C13H21NO
and a molecular weight of 207.32 g/mol. Its IUPAC name is trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine.
Molecular Properties
| Compound Name | trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine |
| PubChem CID | 46945518 |
| Molecular Formula | C13H21NO |
| Molecular Weight | 207.32 g/mol |
| Exact Mass | 207.16 |
| IUPAC Name | trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine |
| SMILES | C#CCO/N=C1\C[C@H](C)CC[C@H]1C(C)C |
| InChI | InChI=1S/C13H21NO/c1-5-8-15-14-13-9-11(4)6-7-12(13)10(2)3/h1,10-12H,6-9H2,2-4H3/b14-13+/t11-,12+/m1/s1 |
| InChIKey | OXLBVXMABYNSMI-WLLWQZAASA-N |
| XLogP | 3.08 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.32 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine?
The IUPAC name of trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine (CID 46945518) is trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine.
What is the SMILES notation for trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine?
The canonical SMILES for trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine is C#CCO/N=C1\C[C@H](C)CC[C@H]1C(C)C.
What is the InChIKey of trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine?
The InChIKey is OXLBVXMABYNSMI-WLLWQZAASA-N. The full InChI is InChI=1S/C13H21NO/c1-5-8-15-14-13-9-11(4)6-7-12(13)10(2)3/h1,10-12H,6-9H2,2-4H3/b14-13+/t11-,12+/m1/s1.
What are the key properties of trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine?
trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine has a molecular weight of 207.32 g/mol, XLogP of 3.08, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for trans-(E,2S,5R)-5-methyl-2-propan-2-yl-N-prop-2-ynoxycyclohexan-1-imine is sourced from PubChem (CID 46945518), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).