About 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol
3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol (PubChem CID 46945638) has the molecular formula C17H18N4O3
and a molecular weight of 326.36 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol.
Molecular Properties
| Compound Name | 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol |
| PubChem CID | 46945638 |
| Molecular Formula | C17H18N4O3 |
| Molecular Weight | 326.36 g/mol |
| Exact Mass | 326.14 |
| IUPAC Name | 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol |
| SMILES | OCc1cn2cc(-c3cccc(O)c3)nc(N3CCOCC3)c2n1 |
| InChI | InChI=1S/C17H18N4O3/c22-11-13-9-21-10-15(12-2-1-3-14(23)8-12)19-17(16(21)18-13)20-4-6-24-7-5-20/h1-3,8-10,22-23H,4-7,11H2 |
| InChIKey | YIALEPQODWJRNQ-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 83.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.36 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol?
The IUPAC name of 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol (CID 46945638) is 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol.
What is the SMILES notation for 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol?
The canonical SMILES for 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol is OCc1cn2cc(-c3cccc(O)c3)nc(N3CCOCC3)c2n1.
What is the InChIKey of 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol?
The InChIKey is YIALEPQODWJRNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N4O3/c22-11-13-9-21-10-15(12-2-1-3-14(23)8-12)19-17(16(21)18-13)20-4-6-24-7-5-20/h1-3,8-10,22-23H,4-7,11H2.
What are the key properties of 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol?
3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol has a molecular weight of 326.36 g/mol, XLogP of 1.43, 3 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-(hydroxymethyl)-8-morpholin-4-ylimidazo[1,2-a]pyrazin-6-yl]phenol is sourced from PubChem (CID 46945638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).