C33H33ClN4O6 — CID 4694624
ethyl 4-(3-chlorophenyl)-6-methyl-1-[[3-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]methyl]-2-oxo-3,4-dihydropyridine-5-carboxylate (PubChem CID 4694624) has the molecular formula C33H33ClN4O6 and a molecular weight of 617.10 g/mol. Its IUPAC name is ethyl 4-(3-chlorophenyl)-6-methyl-1-[[3-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]methyl]-2-oxo-3,4-dihydropyridine-5-carboxylate.
| Compound Name | ethyl 4-(3-chlorophenyl)-6-methyl-1-[[3-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]methyl]-2-oxo-3,4-dihydropyridine-5-carboxylate |
|---|---|
| PubChem CID | 4694624 |
| Molecular Formula | C33H33ClN4O6 |
| Molecular Weight | 617.10 g/mol |
| Exact Mass | 616.21 |
| IUPAC Name | ethyl 4-(3-chlorophenyl)-6-methyl-1-[[3-[4-(4-nitrophenyl)piperazine-1-carbonyl]phenyl]methyl]-2-oxo-3,4-dihydropyridine-5-carboxylate |
| SMILES | CCOC(=O)C1=C(C)N(Cc2cccc(C(=O)N3CCN(c4ccc([N+](=O)[O-])cc4)CC3)c2)C(=O)CC1c1cccc(Cl)c1 |
| InChI | InChI=1S/C33H33ClN4O6/c1-3-44-33(41)31-22(2)37(30(39)20-29(31)24-7-5-9-26(34)19-24)21-23-6-4-8-25(18-23)32(40)36-16-14-35(15-17-36)27-10-12-28(13-11-27)38(42)43/h4-13,18-19,29H,3,14-17,20-21H2,1-2H3 |
| InChIKey | SLYNQLVXDALJTI-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 113.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.10 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|