About diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate
diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate (PubChem CID 46946308) has the molecular formula C24H29NO6S
and a molecular weight of 459.56 g/mol. Its IUPAC name is diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate.
Molecular Properties
| Compound Name | diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate |
| PubChem CID | 46946308 |
| Molecular Formula | C24H29NO6S |
| Molecular Weight | 459.56 g/mol |
| Exact Mass | 459.17 |
| IUPAC Name | diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate |
| SMILES | CCOC(=O)C(C/C=C/[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1)C(=O)OCC |
| InChI | InChI=1S/C24H29NO6S/c1-4-30-23(26)21(24(27)31-5-2)12-9-13-22(19-10-7-6-8-11-19)25-32(28,29)20-16-14-18(3)15-17-20/h6-11,13-17,21-22,25H,4-5,12H2,1-3H3/b13-9+/t22-/m0/s1 |
| InChIKey | KEKDFJPYFPCFSR-XAYKGCCJSA-N |
| XLogP | 3.70 |
| TPSA | 98.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 459.56 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate?
The IUPAC name of diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate (CID 46946308) is diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate.
What is the SMILES notation for diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate?
The canonical SMILES for diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate is CCOC(=O)C(C/C=C/[C@H](NS(=O)(=O)c1ccc(C)cc1)c1ccccc1)C(=O)OCC.
What is the InChIKey of diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate?
The InChIKey is KEKDFJPYFPCFSR-XAYKGCCJSA-N. The full InChI is InChI=1S/C24H29NO6S/c1-4-30-23(26)21(24(27)31-5-2)12-9-13-22(19-10-7-6-8-11-19)25-32(28,29)20-16-14-18(3)15-17-20/h6-11,13-17,21-22,25H,4-5,12H2,1-3H3/b13-9+/t22-/m0/s1.
What are the key properties of diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate?
diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate has a molecular weight of 459.56 g/mol, XLogP of 3.70, 11 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl 2-[(E,4S)-4-[(4-methylphenyl)sulfonylamino]-4-phenylbut-2-enyl]propanedioate is sourced from PubChem (CID 46946308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).