C19H15N7O5 — CID 46946487
9-amino-11-(4-methoxyphenyl)-2,4,6,14,16,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),2,8,12(17)-tetraene-5,7,13,15-tetrone (PubChem CID 46946487) has the molecular formula C19H15N7O5 and a molecular weight of 421.37 g/mol. Its IUPAC name is 9-amino-11-(4-methoxyphenyl)-2,4,6,14,16,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),2,8,12(17)-tetraene-5,7,13,15-tetrone.
| Compound Name | 9-amino-11-(4-methoxyphenyl)-2,4,6,14,16,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),2,8,12(17)-tetraene-5,7,13,15-tetrone |
|---|---|
| PubChem CID | 46946487 |
| Molecular Formula | C19H15N7O5 |
| Molecular Weight | 421.37 g/mol |
| Exact Mass | 421.11 |
| IUPAC Name | 9-amino-11-(4-methoxyphenyl)-2,4,6,14,16,18-hexazatetracyclo[8.8.0.03,8.012,17]octadeca-1(10),2,8,12(17)-tetraene-5,7,13,15-tetrone |
| SMILES | COc1ccc(C2c3c(nc4[nH]c(=O)[nH]c(=O)c4c3N)Nc3[nH]c(=O)[nH]c(=O)c32)cc1 |
| InChI | InChI=1S/C19H15N7O5/c1-31-7-4-2-6(3-5-7)8-9-12(20)11-15(24-19(30)26-17(11)28)22-13(9)21-14-10(8)16(27)25-18(29)23-14/h2-5,8H,1H3,(H7,20,21,22,23,24,25,26,27,28,29,30) |
| InChIKey | XISJQRSXLZOICT-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 191.61 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.37 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |