C22H35O5P — CID 46946827
[2-[(E)-4,8-dimethylnon-1-enyl]-2-methyl-3,4-dihydrochromen-6-yl]oxymethylphosphonic acid (PubChem CID 46946827) has the molecular formula C22H35O5P and a molecular weight of 410.49 g/mol. Its IUPAC name is [2-[(E)-4,8-dimethylnon-1-enyl]-2-methyl-3,4-dihydrochromen-6-yl]oxymethylphosphonic acid.
| Compound Name | [2-[(E)-4,8-dimethylnon-1-enyl]-2-methyl-3,4-dihydrochromen-6-yl]oxymethylphosphonic acid |
|---|---|
| PubChem CID | 46946827 |
| Molecular Formula | C22H35O5P |
| Molecular Weight | 410.49 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | [2-[(E)-4,8-dimethylnon-1-enyl]-2-methyl-3,4-dihydrochromen-6-yl]oxymethylphosphonic acid |
| SMILES | CC(C)CCCC(C)C/C=C/C1(C)CCc2cc(OCP(=O)(O)O)ccc2O1 |
| InChI | InChI=1S/C22H35O5P/c1-17(2)7-5-8-18(3)9-6-13-22(4)14-12-19-15-20(10-11-21(19)27-22)26-16-28(23,24)25/h6,10-11,13,15,17-18H,5,7-9,12,14,16H2,1-4H3,(H2,23,24,25)/b13-6+ |
| InChIKey | OZPAYCMCMAARAQ-AWNIVKPZSA-N |
| XLogP | 5.69 |
| TPSA | 75.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.49 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|