C24H34O7 — CID 46947313
[(1S,8aS)-5-(4-acetyloxy-4-methyl-2,3-dioxopentyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate (PubChem CID 46947313) has the molecular formula C24H34O7 and a molecular weight of 434.53 g/mol. Its IUPAC name is [(1S,8aS)-5-(4-acetyloxy-4-methyl-2,3-dioxopentyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate.
| Compound Name | [(1S,8aS)-5-(4-acetyloxy-4-methyl-2,3-dioxopentyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 46947313 |
| Molecular Formula | C24H34O7 |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.23 |
| IUPAC Name | [(1S,8aS)-5-(4-acetyloxy-4-methyl-2,3-dioxopentyl)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] 2,2-dimethylpropanoate |
| SMILES | CC(=O)OC(C)(C)C(=O)C(=O)CC1=C2CCC[C@H](OC(=O)C(C)(C)C)[C@@]2(C)CCC1=O |
| InChI | InChI=1S/C24H34O7/c1-14(25)31-23(5,6)20(28)18(27)13-15-16-9-8-10-19(30-21(29)22(2,3)4)24(16,7)12-11-17(15)26/h19H,8-13H2,1-7H3/t19-,24-/m0/s1 |
| InChIKey | ACUVFTPLTKAGBN-CYFREDJKSA-N |
| XLogP | 3.66 |
| TPSA | 103.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|