C19H13N3O4S2 — CID 46947464
N-(1,3-benzothiazol-2-yl)-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide (PubChem CID 46947464) has the molecular formula C19H13N3O4S2 and a molecular weight of 411.46 g/mol. Its IUPAC name is N-(1,3-benzothiazol-2-yl)-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide.
| Compound Name | N-(1,3-benzothiazol-2-yl)-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
|---|---|
| PubChem CID | 46947464 |
| Molecular Formula | C19H13N3O4S2 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.03 |
| IUPAC Name | N-(1,3-benzothiazol-2-yl)-2-[4-[(Z)-(2,4-dioxo-1,3-thiazolidin-5-ylidene)methyl]phenoxy]acetamide |
| SMILES | O=C(COc1ccc(/C=C2\SC(=O)NC2=O)cc1)Nc1nc2ccccc2s1 |
| InChI | InChI=1S/C19H13N3O4S2/c23-16(21-18-20-13-3-1-2-4-14(13)27-18)10-26-12-7-5-11(6-8-12)9-15-17(24)22-19(25)28-15/h1-9H,10H2,(H,20,21,23)(H,22,24,25)/b15-9- |
| InChIKey | ZLHFZMQAMFDDFO-DHDCSXOGSA-N |
| XLogP | 3.64 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|