C16H15FN2O2S — CID 46947547
2-(3-fluoropropoxy)-4-(6-methoxy-1-benzothiophen-2-yl)pyrimidine (PubChem CID 46947547) has the molecular formula C16H15FN2O2S and a molecular weight of 318.37 g/mol. Its IUPAC name is 2-(3-fluoropropoxy)-4-(6-methoxy-1-benzothiophen-2-yl)pyrimidine.
| Compound Name | 2-(3-fluoropropoxy)-4-(6-methoxy-1-benzothiophen-2-yl)pyrimidine |
|---|---|
| PubChem CID | 46947547 |
| Molecular Formula | C16H15FN2O2S |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.08 |
| IUPAC Name | 2-(3-fluoropropoxy)-4-(6-methoxy-1-benzothiophen-2-yl)pyrimidine |
| SMILES | COc1ccc2cc(-c3ccnc(OCCCF)n3)sc2c1 |
| InChI | InChI=1S/C16H15FN2O2S/c1-20-12-4-3-11-9-15(22-14(11)10-12)13-5-7-18-16(19-13)21-8-2-6-17/h3-5,7,9-10H,2,6,8H2,1H3 |
| InChIKey | OOOSAGAZXVWXCL-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 44.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|