C27H23F4N3O2 — CID 46947571
6-methyl-2-[2,3,5,6-tetrafluoro-4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid (PubChem CID 46947571) has the molecular formula C27H23F4N3O2 and a molecular weight of 497.49 g/mol. Its IUPAC name is 6-methyl-2-[2,3,5,6-tetrafluoro-4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 6-methyl-2-[2,3,5,6-tetrafluoro-4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 46947571 |
| Molecular Formula | C27H23F4N3O2 |
| Molecular Weight | 497.49 g/mol |
| Exact Mass | 497.17 |
| IUPAC Name | 6-methyl-2-[2,3,5,6-tetrafluoro-4-[4-(piperidin-1-ylmethyl)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2nc(-c3c(F)c(F)c(-c4ccc(CN5CCCCC5)cc4)c(F)c3F)[nH]c2c1 |
| InChI | InChI=1S/C27H23F4N3O2/c1-14-11-17(27(35)36)25-18(12-14)32-26(33-25)20-23(30)21(28)19(22(29)24(20)31)16-7-5-15(6-8-16)13-34-9-3-2-4-10-34/h5-8,11-12H,2-4,9-10,13H2,1H3,(H,32,33)(H,35,36) |
| InChIKey | RPMXVWJPJTZGEC-UHFFFAOYSA-N |
| XLogP | 6.45 |
| TPSA | 69.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.49 |
| LogP ≤ 5 | 6.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|