C21H20F3N7O2 — CID 46947739
1-[3-(methylaminomethyl)-5-[7-(5-methyl-1,3,4-oxadiazol-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea (PubChem CID 46947739) has the molecular formula C21H20F3N7O2 and a molecular weight of 459.43 g/mol. Its IUPAC name is 1-[3-(methylaminomethyl)-5-[7-(5-methyl-1,3,4-oxadiazol-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea.
| Compound Name | 1-[3-(methylaminomethyl)-5-[7-(5-methyl-1,3,4-oxadiazol-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
|---|---|
| PubChem CID | 46947739 |
| Molecular Formula | C21H20F3N7O2 |
| Molecular Weight | 459.43 g/mol |
| Exact Mass | 459.16 |
| IUPAC Name | 1-[3-(methylaminomethyl)-5-[7-(5-methyl-1,3,4-oxadiazol-2-yl)imidazo[1,2-a]pyridin-3-yl]phenyl]-3-(2,2,2-trifluoroethyl)urea |
| SMILES | CNCc1cc(NC(=O)NCC(F)(F)F)cc(-c2cnc3cc(-c4nnc(C)o4)ccn23)c1 |
| InChI | InChI=1S/C21H20F3N7O2/c1-12-29-30-19(33-12)14-3-4-31-17(10-26-18(31)8-14)15-5-13(9-25-2)6-16(7-15)28-20(32)27-11-21(22,23)24/h3-8,10,25H,9,11H2,1-2H3,(H2,27,28,32) |
| InChIKey | IQZDBXPCLXTBMI-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 109.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.43 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |