C26H20F4N4O3 — CID 46947751
6-methyl-2-[2,3,5,6-tetrafluoro-4-[3-(pyrrolidine-2-carbonylamino)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid (PubChem CID 46947751) has the molecular formula C26H20F4N4O3 and a molecular weight of 512.46 g/mol. Its IUPAC name is 6-methyl-2-[2,3,5,6-tetrafluoro-4-[3-(pyrrolidine-2-carbonylamino)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid.
| Compound Name | 6-methyl-2-[2,3,5,6-tetrafluoro-4-[3-(pyrrolidine-2-carbonylamino)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
|---|---|
| PubChem CID | 46947751 |
| Molecular Formula | C26H20F4N4O3 |
| Molecular Weight | 512.46 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 6-methyl-2-[2,3,5,6-tetrafluoro-4-[3-(pyrrolidine-2-carbonylamino)phenyl]phenyl]-1H-benzimidazole-4-carboxylic acid |
| SMILES | Cc1cc(C(=O)O)c2nc(-c3c(F)c(F)c(-c4cccc(NC(=O)C5CCCN5)c4)c(F)c3F)[nH]c2c1 |
| InChI | InChI=1S/C26H20F4N4O3/c1-11-8-14(26(36)37)23-16(9-11)33-24(34-23)18-21(29)19(27)17(20(28)22(18)30)12-4-2-5-13(10-12)32-25(35)15-6-3-7-31-15/h2,4-5,8-10,15,31H,3,6-7H2,1H3,(H,32,35)(H,33,34)(H,36,37) |
| InChIKey | URRUFKLHYVPCHN-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 107.11 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.46 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|