About N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide
N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide (PubChem CID 46947855) has the molecular formula C25H27NO4
and a molecular weight of 405.49 g/mol. Its IUPAC name is N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide.
Molecular Properties
| Compound Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide |
| PubChem CID | 46947855 |
| Molecular Formula | C25H27NO4 |
| Molecular Weight | 405.49 g/mol |
| Exact Mass | 405.19 |
| IUPAC Name | N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide |
| SMILES | CCOc1ccc(CCNC(=O)c2ccc(Oc3ccccc3)cc2)cc1OCC |
| InChI | InChI=1S/C25H27NO4/c1-3-28-23-15-10-19(18-24(23)29-4-2)16-17-26-25(27)20-11-13-22(14-12-20)30-21-8-6-5-7-9-21/h5-15,18H,3-4,16-17H2,1-2H3,(H,26,27) |
| InChIKey | FUDUOOSWCQXIFI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 405.49 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide?
The IUPAC name of N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide (CID 46947855) is N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide.
What is the SMILES notation for N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide?
The canonical SMILES for N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide is CCOc1ccc(CCNC(=O)c2ccc(Oc3ccccc3)cc2)cc1OCC.
What is the InChIKey of N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide?
The InChIKey is FUDUOOSWCQXIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H27NO4/c1-3-28-23-15-10-19(18-24(23)29-4-2)16-17-26-25(27)20-11-13-22(14-12-20)30-21-8-6-5-7-9-21/h5-15,18H,3-4,16-17H2,1-2H3,(H,26,27).
What are the key properties of N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide?
N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide has a molecular weight of 405.49 g/mol, XLogP of 5.25, 10 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[2-(3,4-diethoxyphenyl)ethyl]-4-phenoxybenzamide is sourced from PubChem (CID 46947855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).