About 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide
2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide (PubChem CID 46947866) has the molecular formula C16H19BrN2O3S
and a molecular weight of 399.31 g/mol. Its IUPAC name is 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide.
Molecular Properties
| Compound Name | 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
| PubChem CID | 46947866 |
| Molecular Formula | C16H19BrN2O3S |
| Molecular Weight | 399.31 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide |
| SMILES | CCOc1ccc(CCNC(=O)c2csc(Br)n2)cc1OCC |
| InChI | InChI=1S/C16H19BrN2O3S/c1-3-21-13-6-5-11(9-14(13)22-4-2)7-8-18-15(20)12-10-23-16(17)19-12/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,20) |
| InChIKey | GITVQJQAWDNUTP-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.31 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide?
The IUPAC name of 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide (CID 46947866) is 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide.
What is the SMILES notation for 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide?
The canonical SMILES for 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide is CCOc1ccc(CCNC(=O)c2csc(Br)n2)cc1OCC.
What is the InChIKey of 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide?
The InChIKey is GITVQJQAWDNUTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19BrN2O3S/c1-3-21-13-6-5-11(9-14(13)22-4-2)7-8-18-15(20)12-10-23-16(17)19-12/h5-6,9-10H,3-4,7-8H2,1-2H3,(H,18,20).
What are the key properties of 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide?
2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide has a molecular weight of 399.31 g/mol, XLogP of 3.68, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-N-[2-(3,4-diethoxyphenyl)ethyl]-1,3-thiazole-4-carboxamide is sourced from PubChem (CID 46947866), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).