C16H19N5O — CID 46947912
N,N-dimethyl-3-[[5-([1,2,4]triazolo[4,3-a]pyridin-5-yl)-2-pyridinyl]oxy]propan-1-amine (PubChem CID 46947912) has the molecular formula C16H19N5O and a molecular weight of 297.36 g/mol. Its IUPAC name is N,N-dimethyl-3-[[5-([1,2,4]triazolo[4,3-a]pyridin-5-yl)-2-pyridinyl]oxy]propan-1-amine.
| Compound Name | N,N-dimethyl-3-[[5-([1,2,4]triazolo[4,3-a]pyridin-5-yl)-2-pyridinyl]oxy]propan-1-amine |
|---|---|
| PubChem CID | 46947912 |
| Molecular Formula | C16H19N5O |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.16 |
| IUPAC Name | N,N-dimethyl-3-[[5-([1,2,4]triazolo[4,3-a]pyridin-5-yl)-2-pyridinyl]oxy]propan-1-amine |
| SMILES | CN(C)CCCOc1ccc(-c2cccc3nncn23)cn1 |
| InChI | InChI=1S/C16H19N5O/c1-20(2)9-4-10-22-16-8-7-13(11-17-16)14-5-3-6-15-19-18-12-21(14)15/h3,5-8,11-12H,4,9-10H2,1-2H3 |
| InChIKey | YLBQOTVQXHOOQA-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 55.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|