C16H18F3NO4 — CID 46947955
ethyl 1-[4-methoxy-3-(trifluoromethyl)benzoyl]-2-methylazetidine-2-carboxylate (PubChem CID 46947955) has the molecular formula C16H18F3NO4 and a molecular weight of 345.32 g/mol. Its IUPAC name is ethyl 1-[4-methoxy-3-(trifluoromethyl)benzoyl]-2-methylazetidine-2-carboxylate.
| Compound Name | ethyl 1-[4-methoxy-3-(trifluoromethyl)benzoyl]-2-methylazetidine-2-carboxylate |
|---|---|
| PubChem CID | 46947955 |
| Molecular Formula | C16H18F3NO4 |
| Molecular Weight | 345.32 g/mol |
| Exact Mass | 345.12 |
| IUPAC Name | ethyl 1-[4-methoxy-3-(trifluoromethyl)benzoyl]-2-methylazetidine-2-carboxylate |
| SMILES | CCOC(=O)C1(C)CCN1C(=O)c1ccc(OC)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C16H18F3NO4/c1-4-24-14(22)15(2)7-8-20(15)13(21)10-5-6-12(23-3)11(9-10)16(17,18)19/h5-6,9H,4,7-8H2,1-3H3 |
| InChIKey | XXGVRBWORRMCOD-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.32 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |