C25H24N4O5 — CID 46947961
N-[3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]phenyl]acetamide (PubChem CID 46947961) has the molecular formula C25H24N4O5 and a molecular weight of 460.49 g/mol. Its IUPAC name is N-[3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]phenyl]acetamide.
| Compound Name | N-[3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]phenyl]acetamide |
|---|---|
| PubChem CID | 46947961 |
| Molecular Formula | C25H24N4O5 |
| Molecular Weight | 460.49 g/mol |
| Exact Mass | 460.17 |
| IUPAC Name | N-[3-[8-formamido-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-6-yl]phenyl]acetamide |
| SMILES | COc1cc(-c2cnc3c(NC=O)cc(-c4cccc(NC(C)=O)c4)cn23)cc(OC)c1OC |
| InChI | InChI=1S/C25H24N4O5/c1-15(31)28-19-7-5-6-16(8-19)18-9-20(27-14-30)25-26-12-21(29(25)13-18)17-10-22(32-2)24(34-4)23(11-17)33-3/h5-14H,1-4H3,(H,27,30)(H,28,31) |
| InChIKey | OTFHCHAOKVGXDR-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 103.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.49 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|