About [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol
[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol (PubChem CID 46948046) has the molecular formula C19H15NO3S
and a molecular weight of 337.40 g/mol. Its IUPAC name is [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol.
Molecular Properties
| Compound Name | [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol |
| PubChem CID | 46948046 |
| Molecular Formula | C19H15NO3S |
| Molecular Weight | 337.40 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol |
| SMILES | COc1ccc(C(O)c2nc(-c3cc4ccccc4o3)cs2)cc1 |
| InChI | InChI=1S/C19H15NO3S/c1-22-14-8-6-12(7-9-14)18(21)19-20-15(11-24-19)17-10-13-4-2-3-5-16(13)23-17/h2-11,18,21H,1H3 |
| InChIKey | WXDZWIOBGFZKIX-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 55.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.40 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol?
The IUPAC name of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol (CID 46948046) is [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol.
What is the SMILES notation for [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol?
The canonical SMILES for [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol is COc1ccc(C(O)c2nc(-c3cc4ccccc4o3)cs2)cc1.
What is the InChIKey of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol?
The InChIKey is WXDZWIOBGFZKIX-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H15NO3S/c1-22-14-8-6-12(7-9-14)18(21)19-20-15(11-24-19)17-10-13-4-2-3-5-16(13)23-17/h2-11,18,21H,1H3.
What are the key properties of [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol?
[4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol has a molecular weight of 337.40 g/mol, XLogP of 4.65, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(1-benzofuran-2-yl)-1,3-thiazol-2-yl]-(4-methoxyphenyl)methanol is sourced from PubChem (CID 46948046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).