About (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol
(4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol (PubChem CID 46948094) has the molecular formula C20H16N2O2S
and a molecular weight of 348.43 g/mol. Its IUPAC name is (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol.
Molecular Properties
| Compound Name | (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol |
| PubChem CID | 46948094 |
| Molecular Formula | C20H16N2O2S |
| Molecular Weight | 348.43 g/mol |
| Exact Mass | 348.09 |
| IUPAC Name | (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol |
| SMILES | COc1ccc(C(O)c2nc(-c3cnc4ccccc4c3)cs2)cc1 |
| InChI | InChI=1S/C20H16N2O2S/c1-24-16-8-6-13(7-9-16)19(23)20-22-18(12-25-20)15-10-14-4-2-3-5-17(14)21-11-15/h2-12,19,23H,1H3 |
| InChIKey | IMBMGVAHWRJEIW-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 55.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 348.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol?
The IUPAC name of (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol (CID 46948094) is (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol.
What is the SMILES notation for (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol?
The canonical SMILES for (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol is COc1ccc(C(O)c2nc(-c3cnc4ccccc4c3)cs2)cc1.
What is the InChIKey of (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol?
The InChIKey is IMBMGVAHWRJEIW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H16N2O2S/c1-24-16-8-6-13(7-9-16)19(23)20-22-18(12-25-20)15-10-14-4-2-3-5-17(14)21-11-15/h2-12,19,23H,1H3.
What are the key properties of (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol?
(4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol has a molecular weight of 348.43 g/mol, XLogP of 4.45, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)-(4-quinolin-3-yl-1,3-thiazol-2-yl)methanol is sourced from PubChem (CID 46948094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).