C14H23N5OS — CID 46948133
4-N-[3-(dimethylamino)propyl]-2-N-(2-methoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine (PubChem CID 46948133) has the molecular formula C14H23N5OS and a molecular weight of 309.44 g/mol. Its IUPAC name is 4-N-[3-(dimethylamino)propyl]-2-N-(2-methoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine.
| Compound Name | 4-N-[3-(dimethylamino)propyl]-2-N-(2-methoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 46948133 |
| Molecular Formula | C14H23N5OS |
| Molecular Weight | 309.44 g/mol |
| Exact Mass | 309.16 |
| IUPAC Name | 4-N-[3-(dimethylamino)propyl]-2-N-(2-methoxyethyl)thieno[3,2-d]pyrimidine-2,4-diamine |
| SMILES | COCCNc1nc(NCCCN(C)C)c2sccc2n1 |
| InChI | InChI=1S/C14H23N5OS/c1-19(2)8-4-6-15-13-12-11(5-10-21-12)17-14(18-13)16-7-9-20-3/h5,10H,4,6-9H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | ZGNBTKKSXAKQGC-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 62.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.44 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|