C27H26N4O5 — CID 46948179
N-[3-(3,4-dimethoxyphenyl)-6-[4-(morpholine-4-carbonyl)phenyl]imidazo[1,2-a]pyridin-8-yl]formamide (PubChem CID 46948179) has the molecular formula C27H26N4O5 and a molecular weight of 486.53 g/mol. Its IUPAC name is N-[3-(3,4-dimethoxyphenyl)-6-[4-(morpholine-4-carbonyl)phenyl]imidazo[1,2-a]pyridin-8-yl]formamide.
| Compound Name | N-[3-(3,4-dimethoxyphenyl)-6-[4-(morpholine-4-carbonyl)phenyl]imidazo[1,2-a]pyridin-8-yl]formamide |
|---|---|
| PubChem CID | 46948179 |
| Molecular Formula | C27H26N4O5 |
| Molecular Weight | 486.53 g/mol |
| Exact Mass | 486.19 |
| IUPAC Name | N-[3-(3,4-dimethoxyphenyl)-6-[4-(morpholine-4-carbonyl)phenyl]imidazo[1,2-a]pyridin-8-yl]formamide |
| SMILES | COc1ccc(-c2cnc3c(NC=O)cc(-c4ccc(C(=O)N5CCOCC5)cc4)cn23)cc1OC |
| InChI | InChI=1S/C27H26N4O5/c1-34-24-8-7-20(14-25(24)35-2)23-15-28-26-22(29-17-32)13-21(16-31(23)26)18-3-5-19(6-4-18)27(33)30-9-11-36-12-10-30/h3-8,13-17H,9-12H2,1-2H3,(H,29,32) |
| InChIKey | PQUYGUPOAQQGJP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 94.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.53 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|