About 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide
3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide (PubChem CID 46948394) has the molecular formula C24H27N3O3S
and a molecular weight of 437.57 g/mol. Its IUPAC name is 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide.
Molecular Properties
| Compound Name | 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide |
| PubChem CID | 46948394 |
| Molecular Formula | C24H27N3O3S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide |
| SMILES | CCN(CC)C(=O)c1cccc(-c2csc(C(NC(C)=O)c3cccc(OC)c3)n2)c1 |
| InChI | InChI=1S/C24H27N3O3S/c1-5-27(6-2)24(29)19-11-7-9-17(13-19)21-15-31-23(26-21)22(25-16(3)28)18-10-8-12-20(14-18)30-4/h7-15,22H,5-6H2,1-4H3,(H,25,28) |
| InChIKey | HCJNLXWAGJQZKJ-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide?
The IUPAC name of 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide (CID 46948394) is 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide.
What is the SMILES notation for 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide?
The canonical SMILES for 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide is CCN(CC)C(=O)c1cccc(-c2csc(C(NC(C)=O)c3cccc(OC)c3)n2)c1.
What is the InChIKey of 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide?
The InChIKey is HCJNLXWAGJQZKJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27N3O3S/c1-5-27(6-2)24(29)19-11-7-9-17(13-19)21-15-31-23(26-21)22(25-16(3)28)18-10-8-12-20(14-18)30-4/h7-15,22H,5-6H2,1-4H3,(H,25,28).
What are the key properties of 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide?
3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide has a molecular weight of 437.57 g/mol, XLogP of 4.53, 8 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[2-[acetamido-(3-methoxyphenyl)methyl]-1,3-thiazol-4-yl]-N,N-diethylbenzamide is sourced from PubChem (CID 46948394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).