C24H23N3O5 — CID 46948418
N-[6-(3-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide (PubChem CID 46948418) has the molecular formula C24H23N3O5 and a molecular weight of 433.46 g/mol. Its IUPAC name is N-[6-(3-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide.
| Compound Name | N-[6-(3-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide |
|---|---|
| PubChem CID | 46948418 |
| Molecular Formula | C24H23N3O5 |
| Molecular Weight | 433.46 g/mol |
| Exact Mass | 433.16 |
| IUPAC Name | N-[6-(3-methoxyphenyl)-3-(3,4,5-trimethoxyphenyl)imidazo[1,2-a]pyridin-8-yl]formamide |
| SMILES | COc1cccc(-c2cc(NC=O)c3ncc(-c4cc(OC)c(OC)c(OC)c4)n3c2)c1 |
| InChI | InChI=1S/C24H23N3O5/c1-29-18-7-5-6-15(8-18)17-9-19(26-14-28)24-25-12-20(27(24)13-17)16-10-21(30-2)23(32-4)22(11-16)31-3/h5-14H,1-4H3,(H,26,28) |
| InChIKey | ODTVZWQJBYHSKN-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 83.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|