C18H23N5O2S — CID 46948437
2-[3-(dimethylamino)propylamino]-6-(2-methoxy-3-pyridinyl)-3-methylthieno[3,2-d]pyrimidin-4-one (PubChem CID 46948437) has the molecular formula C18H23N5O2S and a molecular weight of 373.48 g/mol. Its IUPAC name is 2-[3-(dimethylamino)propylamino]-6-(2-methoxy-3-pyridinyl)-3-methylthieno[3,2-d]pyrimidin-4-one.
| Compound Name | 2-[3-(dimethylamino)propylamino]-6-(2-methoxy-3-pyridinyl)-3-methylthieno[3,2-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 46948437 |
| Molecular Formula | C18H23N5O2S |
| Molecular Weight | 373.48 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | 2-[3-(dimethylamino)propylamino]-6-(2-methoxy-3-pyridinyl)-3-methylthieno[3,2-d]pyrimidin-4-one |
| SMILES | COc1ncccc1-c1cc2nc(NCCCN(C)C)n(C)c(=O)c2s1 |
| InChI | InChI=1S/C18H23N5O2S/c1-22(2)10-6-9-20-18-21-13-11-14(26-15(13)17(24)23(18)3)12-7-5-8-19-16(12)25-4/h5,7-8,11H,6,9-10H2,1-4H3,(H,20,21) |
| InChIKey | ZZYJYARFROLMSV-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.48 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|