C18H17FN2O — CID 46948492
(4-ethylphenyl)-[5-(2-fluorophenyl)-1H-imidazol-2-yl]methanol (PubChem CID 46948492) has the molecular formula C18H17FN2O and a molecular weight of 296.34 g/mol. Its IUPAC name is (4-ethylphenyl)-[5-(2-fluorophenyl)-1H-imidazol-2-yl]methanol.
| Compound Name | (4-ethylphenyl)-[5-(2-fluorophenyl)-1H-imidazol-2-yl]methanol |
|---|---|
| PubChem CID | 46948492 |
| Molecular Formula | C18H17FN2O |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | (4-ethylphenyl)-[5-(2-fluorophenyl)-1H-imidazol-2-yl]methanol |
| SMILES | CCc1ccc(C(O)c2ncc(-c3ccccc3F)[nH]2)cc1 |
| InChI | InChI=1S/C18H17FN2O/c1-2-12-7-9-13(10-8-12)17(22)18-20-11-16(21-18)14-5-3-4-6-15(14)19/h3-11,17,22H,2H2,1H3,(H,20,21) |
| InChIKey | XQHURDNPTHCVBS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 48.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |