About N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide
N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide (PubChem CID 46948523) has the molecular formula C21H23N3O2S
and a molecular weight of 381.50 g/mol. Its IUPAC name is N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide.
Molecular Properties
| Compound Name | N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide |
| PubChem CID | 46948523 |
| Molecular Formula | C21H23N3O2S |
| Molecular Weight | 381.50 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide |
| SMILES | CCN(CC)C(=O)c1cccc(-c2csc(C(C)(O)c3ccncc3)n2)c1 |
| InChI | InChI=1S/C21H23N3O2S/c1-4-24(5-2)19(25)16-8-6-7-15(13-16)18-14-27-20(23-18)21(3,26)17-9-11-22-12-10-17/h6-14,26H,4-5H2,1-3H3 |
| InChIKey | PHVHEHHJRDHHCV-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 66.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 381.50 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide?
The IUPAC name of N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide (CID 46948523) is N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide.
What is the SMILES notation for N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide?
The canonical SMILES for N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide is CCN(CC)C(=O)c1cccc(-c2csc(C(C)(O)c3ccncc3)n2)c1.
What is the InChIKey of N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide?
The InChIKey is PHVHEHHJRDHHCV-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H23N3O2S/c1-4-24(5-2)19(25)16-8-6-7-15(13-16)18-14-27-20(23-18)21(3,26)17-9-11-22-12-10-17/h6-14,26H,4-5H2,1-3H3.
What are the key properties of N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide?
N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide has a molecular weight of 381.50 g/mol, XLogP of 3.94, 6 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-diethyl-3-[2-(1-hydroxy-1-pyridin-4-ylethyl)-1,3-thiazol-4-yl]benzamide is sourced from PubChem (CID 46948523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).