C22H19NO5 — CID 46949594
8-(7-methoxy-1,3-benzodioxol-5-yl)-5-oxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),3(7),10,15-tetraen-6-one (PubChem CID 46949594) has the molecular formula C22H19NO5 and a molecular weight of 377.40 g/mol. Its IUPAC name is 8-(7-methoxy-1,3-benzodioxol-5-yl)-5-oxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),3(7),10,15-tetraen-6-one.
| Compound Name | 8-(7-methoxy-1,3-benzodioxol-5-yl)-5-oxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),3(7),10,15-tetraen-6-one |
|---|---|
| PubChem CID | 46949594 |
| Molecular Formula | C22H19NO5 |
| Molecular Weight | 377.40 g/mol |
| Exact Mass | 377.13 |
| IUPAC Name | 8-(7-methoxy-1,3-benzodioxol-5-yl)-5-oxa-2-azatetracyclo[7.7.0.03,7.011,15]hexadeca-1(9),3(7),10,15-tetraen-6-one |
| SMILES | COc1cc(C2C3=C(COC3=O)Nc3cc4c(cc32)CCC4)cc2c1OCO2 |
| InChI | InChI=1S/C22H19NO5/c1-25-17-7-13(8-18-21(17)28-10-27-18)19-14-5-11-3-2-4-12(11)6-15(14)23-16-9-26-22(24)20(16)19/h5-8,19,23H,2-4,9-10H2,1H3 |
| InChIKey | HTJYIHIQSZPFGZ-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |