C9H9N5O5 — CID 46949818
ethyl 5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylate (PubChem CID 46949818) has the molecular formula C9H9N5O5 and a molecular weight of 267.20 g/mol. Its IUPAC name is ethyl 5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylate.
| Compound Name | ethyl 5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylate |
|---|---|
| PubChem CID | 46949818 |
| Molecular Formula | C9H9N5O5 |
| Molecular Weight | 267.20 g/mol |
| Exact Mass | 267.06 |
| IUPAC Name | ethyl 5-[(3-nitro-1,2,4-triazol-1-yl)methyl]-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(Cn2cnc([N+](=O)[O-])n2)on1 |
| InChI | InChI=1S/C9H9N5O5/c1-2-18-8(15)7-3-6(19-12-7)4-13-5-10-9(11-13)14(16)17/h3,5H,2,4H2,1H3 |
| InChIKey | XTFNSFOFHDFENG-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 126.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.20 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|