C20H29N3O7S — CID 46950437
[(3R,5S)-5-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone (PubChem CID 46950437) has the molecular formula C20H29N3O7S and a molecular weight of 455.53 g/mol. Its IUPAC name is [(3R,5S)-5-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone.
| Compound Name | [(3R,5S)-5-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
|---|---|
| PubChem CID | 46950437 |
| Molecular Formula | C20H29N3O7S |
| Molecular Weight | 455.53 g/mol |
| Exact Mass | 455.17 |
| IUPAC Name | [(3R,5S)-5-(3,4-dimethoxyphenyl)-2-methyl-1,1-dioxo-1,2,6-thiadiazinan-3-yl]-(1,4-dioxa-8-azaspiro[4.5]decan-8-yl)methanone |
| SMILES | COc1ccc([C@@H]2C[C@H](C(=O)N3CCC4(CC3)OCCO4)N(C)S(=O)(=O)N2)cc1OC |
| InChI | InChI=1S/C20H29N3O7S/c1-22-16(19(24)23-8-6-20(7-9-23)29-10-11-30-20)13-15(21-31(22,25)26)14-4-5-17(27-2)18(12-14)28-3/h4-5,12,15-16,21H,6-11,13H2,1-3H3/t15-,16+/m0/s1 |
| InChIKey | RGXLXDUYBPGBJB-JKSUJKDBSA-N |
| XLogP | 0.65 |
| TPSA | 106.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.53 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |