C21H20N4O4 — CID 46950546
2-methoxyethyl 2-(5-benzyl-3-oxo-[1,2,4]triazolo[4,3-c]quinazolin-2-yl)acetate (PubChem CID 46950546) has the molecular formula C21H20N4O4 and a molecular weight of 392.42 g/mol. Its IUPAC name is 2-methoxyethyl 2-(5-benzyl-3-oxo-[1,2,4]triazolo[4,3-c]quinazolin-2-yl)acetate.
| Compound Name | 2-methoxyethyl 2-(5-benzyl-3-oxo-[1,2,4]triazolo[4,3-c]quinazolin-2-yl)acetate |
|---|---|
| PubChem CID | 46950546 |
| Molecular Formula | C21H20N4O4 |
| Molecular Weight | 392.42 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 2-methoxyethyl 2-(5-benzyl-3-oxo-[1,2,4]triazolo[4,3-c]quinazolin-2-yl)acetate |
| SMILES | COCCOC(=O)Cn1nc2c3ccccc3nc(Cc3ccccc3)n2c1=O |
| InChI | InChI=1S/C21H20N4O4/c1-28-11-12-29-19(26)14-24-21(27)25-18(13-15-7-3-2-4-8-15)22-17-10-6-5-9-16(17)20(25)23-24/h2-10H,11-14H2,1H3 |
| InChIKey | HYLKRQWZSFCRLB-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 87.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.42 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|