C25H31N5O2 — CID 46950835
N-(3-ethoxypropyl)-6-[(4-methoxyphenyl)methyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine (PubChem CID 46950835) has the molecular formula C25H31N5O2 and a molecular weight of 433.56 g/mol. Its IUPAC name is N-(3-ethoxypropyl)-6-[(4-methoxyphenyl)methyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine.
| Compound Name | N-(3-ethoxypropyl)-6-[(4-methoxyphenyl)methyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 46950835 |
| Molecular Formula | C25H31N5O2 |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.25 |
| IUPAC Name | N-(3-ethoxypropyl)-6-[(4-methoxyphenyl)methyl]-2-pyridin-2-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-4-amine |
| SMILES | CCOCCCNc1nc(-c2ccccn2)nc2c1CN(Cc1ccc(OC)cc1)CC2 |
| InChI | InChI=1S/C25H31N5O2/c1-3-32-16-6-14-27-24-21-18-30(17-19-8-10-20(31-2)11-9-19)15-12-22(21)28-25(29-24)23-7-4-5-13-26-23/h4-5,7-11,13H,3,6,12,14-18H2,1-2H3,(H,27,28,29) |
| InChIKey | KANPAIFYXXOBSZ-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 72.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|