C26H35N3O — CID 46952067
2-(4-methylpiperidin-1-yl)-2-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide (PubChem CID 46952067) has the molecular formula C26H35N3O and a molecular weight of 405.59 g/mol. Its IUPAC name is 2-(4-methylpiperidin-1-yl)-2-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide.
| Compound Name | 2-(4-methylpiperidin-1-yl)-2-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
|---|---|
| PubChem CID | 46952067 |
| Molecular Formula | C26H35N3O |
| Molecular Weight | 405.59 g/mol |
| Exact Mass | 405.28 |
| IUPAC Name | 2-(4-methylpiperidin-1-yl)-2-phenyl-N-[(4-piperidin-1-ylphenyl)methyl]acetamide |
| SMILES | CC1CCN(C(C(=O)NCc2ccc(N3CCCCC3)cc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C26H35N3O/c1-21-14-18-29(19-15-21)25(23-8-4-2-5-9-23)26(30)27-20-22-10-12-24(13-11-22)28-16-6-3-7-17-28/h2,4-5,8-13,21,25H,3,6-7,14-20H2,1H3,(H,27,30) |
| InChIKey | FAFYXAARWIMOSM-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.59 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|