C23H24N4O2S — CID 46952164
10-[2-(azepan-1-yl)-2-oxoethyl]-12-phenyl-5-thia-1,10,11-triazatricyclo[6.5.0.02,6]trideca-2(6),3,7,11-tetraen-9-one (PubChem CID 46952164) has the molecular formula C23H24N4O2S and a molecular weight of 420.54 g/mol. Its IUPAC name is 10-[2-(azepan-1-yl)-2-oxoethyl]-12-phenyl-5-thia-1,10,11-triazatricyclo[6.5.0.02,6]trideca-2(6),3,7,11-tetraen-9-one.
| Compound Name | 10-[2-(azepan-1-yl)-2-oxoethyl]-12-phenyl-5-thia-1,10,11-triazatricyclo[6.5.0.02,6]trideca-2(6),3,7,11-tetraen-9-one |
|---|---|
| PubChem CID | 46952164 |
| Molecular Formula | C23H24N4O2S |
| Molecular Weight | 420.54 g/mol |
| Exact Mass | 420.16 |
| IUPAC Name | 10-[2-(azepan-1-yl)-2-oxoethyl]-12-phenyl-5-thia-1,10,11-triazatricyclo[6.5.0.02,6]trideca-2(6),3,7,11-tetraen-9-one |
| SMILES | O=C(CN1N=C(c2ccccc2)Cn2c(cc3sccc32)C1=O)N1CCCCCC1 |
| InChI | InChI=1S/C23H24N4O2S/c28-22(25-11-6-1-2-7-12-25)16-27-23(29)20-14-21-19(10-13-30-21)26(20)15-18(24-27)17-8-4-3-5-9-17/h3-5,8-10,13-14H,1-2,6-7,11-12,15-16H2 |
| InChIKey | HYFAVFCCXLQGNI-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 57.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.54 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |