C21H28N4O2 — CID 46952784
N-(2-cyclohexyl-6-oxopiperidin-3-yl)-2-(2-methylbenzimidazol-1-yl)acetamide (PubChem CID 46952784) has the molecular formula C21H28N4O2 and a molecular weight of 368.48 g/mol. Its IUPAC name is N-(2-cyclohexyl-6-oxopiperidin-3-yl)-2-(2-methylbenzimidazol-1-yl)acetamide.
| Compound Name | N-(2-cyclohexyl-6-oxopiperidin-3-yl)-2-(2-methylbenzimidazol-1-yl)acetamide |
|---|---|
| PubChem CID | 46952784 |
| Molecular Formula | C21H28N4O2 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.22 |
| IUPAC Name | N-(2-cyclohexyl-6-oxopiperidin-3-yl)-2-(2-methylbenzimidazol-1-yl)acetamide |
| SMILES | Cc1nc2ccccc2n1CC(=O)NC1CCC(=O)NC1C1CCCCC1 |
| InChI | InChI=1S/C21H28N4O2/c1-14-22-16-9-5-6-10-18(16)25(14)13-20(27)23-17-11-12-19(26)24-21(17)15-7-3-2-4-8-15/h5-6,9-10,15,17,21H,2-4,7-8,11-13H2,1H3,(H,23,27)(H,24,26) |
| InChIKey | FXMGXJAYIRJZQT-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |