C20H22N4O2 — CID 46953104
5,6-bis(2-methoxyphenyl)-N-propan-2-yl-1,2,4-triazin-3-amine (PubChem CID 46953104) has the molecular formula C20H22N4O2 and a molecular weight of 350.42 g/mol. Its IUPAC name is 5,6-bis(2-methoxyphenyl)-N-propan-2-yl-1,2,4-triazin-3-amine.
| Compound Name | 5,6-bis(2-methoxyphenyl)-N-propan-2-yl-1,2,4-triazin-3-amine |
|---|---|
| PubChem CID | 46953104 |
| Molecular Formula | C20H22N4O2 |
| Molecular Weight | 350.42 g/mol |
| Exact Mass | 350.17 |
| IUPAC Name | 5,6-bis(2-methoxyphenyl)-N-propan-2-yl-1,2,4-triazin-3-amine |
| SMILES | COc1ccccc1-c1nnc(NC(C)C)nc1-c1ccccc1OC |
| InChI | InChI=1S/C20H22N4O2/c1-13(2)21-20-22-18(14-9-5-7-11-16(14)25-3)19(23-24-20)15-10-6-8-12-17(15)26-4/h5-13H,1-4H3,(H,21,22,24) |
| InChIKey | YVXYDABWEZEUIO-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 69.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.42 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |