C22H32N4O — CID 46953523
2-[(3S)-2-[[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol (PubChem CID 46953523) has the molecular formula C22H32N4O and a molecular weight of 368.53 g/mol. Its IUPAC name is 2-[(3S)-2-[[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol.
| Compound Name | 2-[(3S)-2-[[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol |
|---|---|
| PubChem CID | 46953523 |
| Molecular Formula | C22H32N4O |
| Molecular Weight | 368.53 g/mol |
| Exact Mass | 368.26 |
| IUPAC Name | 2-[(3S)-2-[[3,5-dimethyl-1-(2-methylphenyl)pyrazol-4-yl]methyl]-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-3-yl]ethanol |
| SMILES | Cc1ccccc1-n1nc(C)c(CN2CC3CCCN3C[C@@H]2CCO)c1C |
| InChI | InChI=1S/C22H32N4O/c1-16-7-4-5-9-22(16)26-18(3)21(17(2)23-26)15-25-14-19-8-6-11-24(19)13-20(25)10-12-27/h4-5,7,9,19-20,27H,6,8,10-15H2,1-3H3/t19?,20-/m0/s1 |
| InChIKey | XFROIBJPMUUNTR-ANYOKISRSA-N |
| XLogP | 2.83 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |