C20H26N4OS — CID 46953636
[1-[12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-yl]methanol (PubChem CID 46953636) has the molecular formula C20H26N4OS and a molecular weight of 370.52 g/mol. Its IUPAC name is [1-[12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-yl]methanol.
| Compound Name | [1-[12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-yl]methanol |
|---|---|
| PubChem CID | 46953636 |
| Molecular Formula | C20H26N4OS |
| Molecular Weight | 370.52 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | [1-[12-(thiophen-2-ylmethyl)-4,6,12-triazatricyclo[7.2.1.02,7]dodeca-2,4,6-trien-5-yl]piperidin-3-yl]methanol |
| SMILES | OCC1CCCN(c2ncc3c(n2)CC2CCC3N2Cc2cccs2)C1 |
| InChI | InChI=1S/C20H26N4OS/c25-13-14-3-1-7-23(11-14)20-21-10-17-18(22-20)9-15-5-6-19(17)24(15)12-16-4-2-8-26-16/h2,4,8,10,14-15,19,25H,1,3,5-7,9,11-13H2 |
| InChIKey | ASPBQXCPLUSKKZ-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.52 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |